raaeraae22
raaeraae22
04-02-2017
Chemistry
contestada
When is di- used in the name of a hydrocarbon?
Respuesta :
DoctorCass
DoctorCass
04-02-2017
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer Link
VER TODAS LAS RESPUESTAS ( 51+ )
Otras preguntas
Which equation shows y=−12x+4y=−12x+4 in standard form
In examining an unknown animal species during its embryonic development, how can you be sure what you are looking at is a protostome and not a deuterostome?
A scientist is measuring the pressure that is exerted by each of the following gases in the atmosphere: carbon dioxide, oxygen, and nitrogen. Which term most li
Explain why noble gases usually do not form bonds with other atoms?
Please help I need this fast You mix a blue and clear liquid and they turn a bright green.Has a chemical reaction occurred?Why or why not?
Raul plans to spend no more than $78.00 on two shirts and a pair of jeans. he bought the two shirts for $19.89 each. how much can he spend on the jeans
Mike put 280 baseballs into 10 trash bins. He put the same number of baseballs in each bin. He took 5 trash bins of baseballs to the baseball field. How many ba
3⋅ 3/5 (3/5 is a fraction)
The term racial unconscious means that A. each species and culture shares ancient memories, stored in the unconscious part of the mind. B. nature weeds o
FROM act 5, what does the first vision look like and what does it warn? In the book "Macbeth"